Products 2115897-27-1

CAS 2115897-27-1 is the registry number for Aniline-PEG3-C1-Boc, 98.26%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 25 mg, 10 mg, 50 mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[2-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]ethoxy]acetate (CAS 2115897-27-1) is a chemical compound with the molecular formula C18H29NO6 and a molecular weight of 355.4 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]ethoxy]acetate. InChIKey: OTBIXAAPJQRYMW-UHFFFAOYSA-N.

Identity
Molecular formulaC18H29NO6
Molecular weight355.4 g/mol
IUPAC nametert-butyl 2-[2-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]ethoxy]acetate
InChIKeyOTBIXAAPJQRYMW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)COCCOCCOCCOC1=CC=C(C=C1)N

Computed by PubChem (NCBI)