CAS 1809098-72-3 is the registry number for 5-Acetyl-2-(3-aminophenoxy) pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[6-(3-aminophenoxy)-3-pyridinyl]ethanone (CAS 1809098-72-3) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 1-[6-(3-aminophenoxy)-3-pyridinyl]ethanone. InChIKey: JAYDYZRSDDSVQI-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 1-[6-(3-aminophenoxy)-3-pyridinyl]ethanone |
| InChIKey | JAYDYZRSDDSVQI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)