CAS 1809098-74-5 is the registry number for 5-Acetyl-2-(2-benzoyl-4-methoxyphenoxy) pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[6-(2-benzoyl-4-methoxyphenoxy)-3-pyridinyl]ethanone (CAS 1809098-74-5) is a chemical compound with the molecular formula C21H17NO4 and a molecular weight of 347.4 g/mol. IUPAC name: 1-[6-(2-benzoyl-4-methoxyphenoxy)-3-pyridinyl]ethanone. InChIKey: KRDRTZXRZVJWIG-UHFFFAOYSA-N.
| Molecular formula | C21H17NO4 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 1-[6-(2-benzoyl-4-methoxyphenoxy)-3-pyridinyl]ethanone |
| InChIKey | KRDRTZXRZVJWIG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=C(C=C(C=C2)OC)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)