Products 794552-29-7
CAS 794552-29-7 is the registry number for Isopropyl 2-methyl-6,11-dioxo-6,11-dihydrobenzo(f)pyrido(1,2-a)indole-12-carboxylate. Offered by: Biosynth. Available pack sizes: 2mg, 5mg, 10mg, 50mg, 25mg.
Propan-2-yl 2-methyl-6,11-dioxonaphtho[2,3-b]indolizine-12-carboxylate (CAS 794552-29-7) is a chemical compound with the molecular formula C21H17NO4 and a molecular weight of 347.4 g/mol. IUPAC name: propan-2-yl 2-methyl-6,11-dioxonaphtho[2,3-b]indolizine-12-carboxylate. InChIKey: WJMQRRBYCNLMNP-UHFFFAOYSA-N.
| Molecular formula | C21H17NO4 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | propan-2-yl 2-methyl-6,11-dioxonaphtho[2,3-b]indolizine-12-carboxylate |
| InChIKey | WJMQRRBYCNLMNP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C(N2C=C1)C(=O)C4=CC=CC=C4C3=O)C(=O)OC(C)C |
Computed by PubChem (NCBI)