CAS 1809158-01-7 is the registry number for 5-Bromo-3,4-difluoro-2-(trimethylsilyl)benzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
5-bromo-3,4-difluoro-2-trimethylsilylbenzaldehyde (CAS 1809158-01-7) is a chemical compound with the molecular formula C10H11BrF2OSi and a molecular weight of 293.18 g/mol. IUPAC name: 5-bromo-3,4-difluoro-2-trimethylsilylbenzaldehyde. InChIKey: FZJZGTNKNCHMAH-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2OSi |
|---|---|
| Molecular weight | 293.18 g/mol |
| IUPAC name | 5-bromo-3,4-difluoro-2-trimethylsilylbenzaldehyde |
| InChIKey | FZJZGTNKNCHMAH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C(=C(C=C1C=O)Br)F)F |
Computed by PubChem (NCBI)