CAS 633327-21-6 is the registry number for 5-Bromo-2,3-difluoro-4-(trimethylsilyl)benzaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-bromo-2,3-difluoro-4-trimethylsilylbenzaldehyde (CAS 633327-21-6) is a chemical compound with the molecular formula C10H11BrF2OSi and a molecular weight of 293.18 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-trimethylsilylbenzaldehyde. InChIKey: SLHAXIGCLNMNOC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2OSi |
|---|---|
| Molecular weight | 293.18 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-trimethylsilylbenzaldehyde |
| InChIKey | SLHAXIGCLNMNOC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=C(C(=C1F)F)C=O)Br |
Computed by PubChem (NCBI)