Products 1809158-04-0
CAS 1809158-04-0 is the registry number for N,N-Diethyl 4-bromo-2-(trifluoromethy)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
4-bromo-N,N-diethyl-2-(trifluoromethyl)benzamide (CAS 1809158-04-0) is a chemical compound with the molecular formula C12H13BrF3NO and a molecular weight of 324.14 g/mol. IUPAC name: 4-bromo-N,N-diethyl-2-(trifluoromethyl)benzamide. InChIKey: HQDJUUYXPROABQ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO |
|---|---|
| Molecular weight | 324.14 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-2-(trifluoromethyl)benzamide |
| InChIKey | HQDJUUYXPROABQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)