Products 391220-21-6
CAS 391220-21-6 is the registry number for 2-Bromo-3-methyl-N-(3-(trifluoromethyl)phenyl)butanamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-bromo-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide (CAS 391220-21-6) is a chemical compound with the molecular formula C12H13BrF3NO and a molecular weight of 324.14 g/mol. IUPAC name: 2-bromo-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide. InChIKey: JVTVKJUQXSWMPT-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO |
|---|---|
| Molecular weight | 324.14 g/mol |
| IUPAC name | 2-bromo-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide |
| InChIKey | JVTVKJUQXSWMPT-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC1=CC=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)