Products 1809167-48-3
CAS 1809167-48-3 is the registry number for Antifungal agent 32. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,5S)-2-benzyl-5-[(4-phenylmethoxyphenyl)methyl]piperazine (CAS 1809167-48-3) is a chemical compound with the molecular formula C25H28N2O and a molecular weight of 372.5 g/mol. IUPAC name: (2S,5S)-2-benzyl-5-[(4-phenylmethoxyphenyl)methyl]piperazine. InChIKey: GMHWCRVBSHSBCE-ZEQRLZLVSA-N.
| Molecular formula | C25H28N2O |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | (2S,5S)-2-benzyl-5-[(4-phenylmethoxyphenyl)methyl]piperazine |
| InChIKey | GMHWCRVBSHSBCE-ZEQRLZLVSA-N |
| SMILES | C1[C@@H](NC[C@@H](N1)CC2=CC=C(C=C2)OCC3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)