CAS 1809168-61-3 is the registry number for 2-Bromo-5-chloro-4-methoxyacetophenone, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
1-(2-bromo-5-chloro-4-methoxyphenyl)ethanone (CAS 1809168-61-3) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 1-(2-bromo-5-chloro-4-methoxyphenyl)ethanone. InChIKey: WHOLVSNWJHQDKM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 1-(2-bromo-5-chloro-4-methoxyphenyl)ethanone |
| InChIKey | WHOLVSNWJHQDKM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1Br)OC)Cl |
Computed by PubChem (NCBI)