CAS 1809168-67-9 is the registry number for 3-Bromo-5-iodopyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
3-bromo-5-iodopyridine-4-carboxylic acid (CAS 1809168-67-9) is a chemical compound with the molecular formula C6H3BrINO2 and a molecular weight of 327.90 g/mol. IUPAC name: 3-bromo-5-iodopyridine-4-carboxylic acid. InChIKey: QZGCFTPCRQVMAZ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrINO2 |
|---|---|
| Molecular weight | 327.90 g/mol |
| IUPAC name | 3-bromo-5-iodopyridine-4-carboxylic acid |
| InChIKey | QZGCFTPCRQVMAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)I)C(=O)O)Br |
Computed by PubChem (NCBI)