Products 1809168-67-9

CAS 1809168-67-9 is the registry number for 3-Bromo-5-iodopyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-5-iodopyridine-4-carboxylic acid (CAS 1809168-67-9) is a chemical compound with the molecular formula C6H3BrINO2 and a molecular weight of 327.90 g/mol. IUPAC name: 3-bromo-5-iodopyridine-4-carboxylic acid. InChIKey: QZGCFTPCRQVMAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrINO2
Molecular weight327.90 g/mol
IUPAC name3-bromo-5-iodopyridine-4-carboxylic acid
InChIKeyQZGCFTPCRQVMAZ-UHFFFAOYSA-N
SMILESC1=C(C(=C(C=N1)I)C(=O)O)Br

Computed by PubChem (NCBI)