CAS 491588-98-8 appears in our catalog under these names: 5-Bromo-4-iodonicotinic acid, 95%, 5-Bromo-4-iodonicotinic acid 95%, 5-Bromo-4-iodonicotinic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-bromo-4-iodopyridine-3-carboxylic acid (CAS 491588-98-8) is a chemical compound with the molecular formula C6H3BrINO2 and a molecular weight of 327.90 g/mol. IUPAC name: 5-bromo-4-iodopyridine-3-carboxylic acid. InChIKey: DDILUXVGWWORKX-UHFFFAOYSA-N.
| Molecular formula | C6H3BrINO2 |
|---|---|
| Molecular weight | 327.90 g/mol |
| IUPAC name | 5-bromo-4-iodopyridine-3-carboxylic acid |
| InChIKey | DDILUXVGWWORKX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)I)C(=O)O |
Computed by PubChem (NCBI)