CAS 1809205-40-0 is the registry number for Methyl 6-amino-2,2-dimethylindoline-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-amino-2,2-dimethyl-3H-indole-1-carboxylate (CAS 1809205-40-0) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: methyl 6-amino-2,2-dimethyl-3H-indole-1-carboxylate. InChIKey: VKVIJVSXDWOPGV-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | methyl 6-amino-2,2-dimethyl-3H-indole-1-carboxylate |
| InChIKey | VKVIJVSXDWOPGV-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(N1C(=O)OC)C=C(C=C2)N)C |
Computed by PubChem (NCBI)