CAS 1809517-32-5 is the registry number for Hydroxyanastrozole. Offered by: TRC. Available pack sizes: 25mg.
2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-3-hydroxy-2-methylpropanenitrile (CAS 1809517-32-5) is a chemical compound with the molecular formula C17H19N5O and a molecular weight of 309.4 g/mol. IUPAC name: 2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-3-hydroxy-2-methylpropanenitrile. InChIKey: OQTXFTNVWHOUNW-UHFFFAOYSA-N.
| Molecular formula | C17H19N5O |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-3-hydroxy-2-methylpropanenitrile |
| InChIKey | OQTXFTNVWHOUNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC(=CC(=C1)CN2C=NC=N2)C(C)(CO)C#N |
Computed by PubChem (NCBI)