Products 867054-13-5
CAS 867054-13-5 is the registry number for ATL444. Offered by: MedChemExpress. Available pack sizes: Get quote.
Trans-(1S,3R)-1-[2-(6-amino-9-prop-2-ynylpurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol (CAS 867054-13-5) is a chemical compound with the molecular formula C17H19N5O and a molecular weight of 309.4 g/mol. IUPAC name: trans-(1S,3R)-1-[2-(6-amino-9-prop-2-ynylpurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol. InChIKey: VEJLEEFUXFQSHP-SJKOYZFVSA-N.
| Molecular formula | C17H19N5O |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | trans-(1S,3R)-1-[2-(6-amino-9-prop-2-ynylpurin-2-yl)ethynyl]-3-methylcyclohexan-1-ol |
| InChIKey | VEJLEEFUXFQSHP-SJKOYZFVSA-N |
| SMILES | C[C@@H]1CCC[C@](C1)(C#CC2=NC(=C3C(=N2)N(C=N3)CC#C)N)O |
Computed by PubChem (NCBI)