Products 1809815-85-7

CAS 1809815-85-7 is the registry number for 2,5-Bis(methacryloyloxy)terephthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,5-bis(2-methylprop-2-enoyloxy)terephthalic acid (CAS 1809815-85-7) is a chemical compound with the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. IUPAC name: 2,5-bis(2-methylprop-2-enoyloxy)terephthalic acid. InChIKey: VQCPPNUDHJFVND-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14O8
Molecular weight334.28 g/mol
IUPAC name2,5-bis(2-methylprop-2-enoyloxy)terephthalic acid
InChIKeyVQCPPNUDHJFVND-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OC1=CC(=C(C=C1C(=O)O)OC(=O)C(=C)C)C(=O)O

Computed by PubChem (NCBI)