CAS 911315-93-0 is the registry number for Jaboticabin. Offered by: TRC. Available pack sizes: 250mg.
[3,5-dihydroxy-2-(2-methoxy-2-oxoethyl)phenyl] 3,4-dihydroxybenzoate (CAS 911315-93-0) is a chemical compound with the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. IUPAC name: [3,5-dihydroxy-2-(2-methoxy-2-oxoethyl)phenyl] 3,4-dihydroxybenzoate. InChIKey: LFLJQGHNYLKTBB-UHFFFAOYSA-N.
| Molecular formula | C16H14O8 |
|---|---|
| Molecular weight | 334.28 g/mol |
| IUPAC name | [3,5-dihydroxy-2-(2-methoxy-2-oxoethyl)phenyl] 3,4-dihydroxybenzoate |
| InChIKey | LFLJQGHNYLKTBB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1OC(=O)C2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)