CAS 180991-55-3 appears in our catalog under these names: 3-(Cyclohexanecarboxamido)benzoic acid, 95%, 3-((Cyclohexylcarbonyl)amino)benzoic acid, 3-[(Cyclohexylcarbonyl)amino]benzoic acid, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 5g, 250mg, 2,5g, 1g.
3-(cyclohexanecarbonylamino)benzoic acid (CAS 180991-55-3) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 3-(cyclohexanecarbonylamino)benzoic acid. InChIKey: UKYBHQDUVKBFFX-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 3-(cyclohexanecarbonylamino)benzoic acid |
| InChIKey | UKYBHQDUVKBFFX-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)