Products 1810068-27-9
CAS 1810068-27-9 is the registry number for 2,6-BIS(DIMETHYLAMINO)-2'-BROMO-3',6'-DIMETHOXY-1,1'-BIPHENYL, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 100mg, 250mg.
2-(2-bromo-3,6-dimethoxyphenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine (CAS 1810068-27-9) is a chemical compound with the molecular formula C18H23BrN2O2 and a molecular weight of 379.3 g/mol. IUPAC name: 2-(2-bromo-3,6-dimethoxyphenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine. InChIKey: IAZZKJSYJGTEJG-UHFFFAOYSA-N.
| Molecular formula | C18H23BrN2O2 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 2-(2-bromo-3,6-dimethoxyphenyl)-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine |
| InChIKey | IAZZKJSYJGTEJG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=CC=C1)N(C)C)C2=C(C=CC(=C2Br)OC)OC |
Computed by PubChem (NCBI)