CAS 1858256-79-7 appears in our catalog under these names: tert-Butyl 8-bromo-5-ethyl-1,3,4,5-tetrahydro-2h-pyrido[4,3-b]indole-2-carboxylate, 95%, tert-Butyl 8-bromo-5-ethyl-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indole-2-carboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
Tert-butyl 8-bromo-5-ethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate (CAS 1858256-79-7) is a chemical compound with the molecular formula C18H23BrN2O2 and a molecular weight of 379.3 g/mol. IUPAC name: tert-butyl 8-bromo-5-ethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate. InChIKey: NBNVZRJGTHEHFM-UHFFFAOYSA-N.
| Molecular formula | C18H23BrN2O2 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | tert-butyl 8-bromo-5-ethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| InChIKey | NBNVZRJGTHEHFM-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(CN(CC2)C(=O)OC(C)(C)C)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)