CAS 1810070-26-8 appears in our catalog under these names: 5-(Trifluoromethoxy)-2,3-dihydro-1h-isoindole hydrochloride, 95%, 5-(Trifluoromethoxy)isoindoline hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-(trifluoromethoxy)-2,3-dihydro-1H-isoindole;hydrochloride (CAS 1810070-26-8) is a chemical compound with the molecular formula C9H9ClF3NO and a molecular weight of 239.62 g/mol. IUPAC name: 5-(trifluoromethoxy)-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: RMGPTDQFDTURME-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO |
|---|---|
| Molecular weight | 239.62 g/mol |
| IUPAC name | 5-(trifluoromethoxy)-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | RMGPTDQFDTURME-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)