CAS 339-58-2 appears in our catalog under these names: 2-Amino-1-(4-(trifluoromethyl)phenyl)ethanonehydrochloride, 95%, 2-Amino-1-(4-(trifluoromethyl)phenyl)ethanone hydrochloride, 96%, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
2-amino-1-[4-(trifluoromethyl)phenyl]ethanone;hydrochloride (CAS 339-58-2) is a chemical compound with the molecular formula C9H9ClF3NO and a molecular weight of 239.62 g/mol. IUPAC name: 2-amino-1-[4-(trifluoromethyl)phenyl]ethanone;hydrochloride. InChIKey: APBKZMJARWKEJO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO |
|---|---|
| Molecular weight | 239.62 g/mol |
| IUPAC name | 2-amino-1-[4-(trifluoromethyl)phenyl]ethanone;hydrochloride |
| InChIKey | APBKZMJARWKEJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)