Products 181122-00-9
CAS 181122-00-9 appears in our catalog under these names: 4,4,6-Trimethyl-1,3-dihydroquinolin-2-one, 98%, 4,4,6-Trimethyl-3,4-dihydroquinolin-2(1H)-one, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
4,4,6-trimethyl-1,3-dihydroquinolin-2-one (CAS 181122-00-9) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 4,4,6-trimethyl-1,3-dihydroquinolin-2-one. InChIKey: XQSXUDFDIMWBNI-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 4,4,6-trimethyl-1,3-dihydroquinolin-2-one |
| InChIKey | XQSXUDFDIMWBNI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)CC2(C)C |
Computed by PubChem (NCBI)