Products 18113-45-6
CAS 18113-45-6 appears in our catalog under these names: 2,6-Dimethoxyphenyl benzenesulfonate, 98%, 98%, 2,6-Dimethoxyphenyl benzenesulfonate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(2,6-dimethoxyphenyl) benzenesulfonate (CAS 18113-45-6) is a chemical compound with the molecular formula C14H14O5S and a molecular weight of 294.32 g/mol. IUPAC name: (2,6-dimethoxyphenyl) benzenesulfonate. InChIKey: VYVBAWXHMGYNPV-UHFFFAOYSA-N.
| Molecular formula | C14H14O5S |
|---|---|
| Molecular weight | 294.32 g/mol |
| IUPAC name | (2,6-dimethoxyphenyl) benzenesulfonate |
| InChIKey | VYVBAWXHMGYNPV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)OS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)