CAS 696648-31-4 appears in our catalog under these names: 5-([(3-Methylbenzyl)sulfonyl]methyl)-2-furoic acid, 95%, 5-(((3-Methylbenzyl)sulfonyl)methyl)furan-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxylic acid (CAS 696648-31-4) is a chemical compound with the molecular formula C14H14O5S and a molecular weight of 294.32 g/mol. IUPAC name: 5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxylic acid. InChIKey: LAKIDDKKBBYVHO-UHFFFAOYSA-N.
| Molecular formula | C14H14O5S |
|---|---|
| Molecular weight | 294.32 g/mol |
| IUPAC name | 5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxylic acid |
| InChIKey | LAKIDDKKBBYVHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CS(=O)(=O)CC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)