CAS 897775-93-8 is the registry number for Methyl 5-(((4-methylphenyl)sulfonyl)methyl)furan-2-carboxylate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Methyl 5-[(4-methylphenyl)sulfonylmethyl]furan-2-carboxylate (CAS 897775-93-8) is a chemical compound with the molecular formula C14H14O5S and a molecular weight of 294.32 g/mol. IUPAC name: methyl 5-[(4-methylphenyl)sulfonylmethyl]furan-2-carboxylate. InChIKey: ZIQVEAJAOQEMSS-UHFFFAOYSA-N.
| Molecular formula | C14H14O5S |
|---|---|
| Molecular weight | 294.32 g/mol |
| IUPAC name | methyl 5-[(4-methylphenyl)sulfonylmethyl]furan-2-carboxylate |
| InChIKey | ZIQVEAJAOQEMSS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC2=CC=C(O2)C(=O)OC |
Computed by PubChem (NCBI)