Products 897775-93-8

CAS 897775-93-8 is the registry number for Methyl 5-(((4-methylphenyl)sulfonyl)methyl)furan-2-carboxylate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(4-methylphenyl)sulfonylmethyl]furan-2-carboxylate (CAS 897775-93-8) is a chemical compound with the molecular formula C14H14O5S and a molecular weight of 294.32 g/mol. IUPAC name: methyl 5-[(4-methylphenyl)sulfonylmethyl]furan-2-carboxylate. InChIKey: ZIQVEAJAOQEMSS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O5S
Molecular weight294.32 g/mol
IUPAC namemethyl 5-[(4-methylphenyl)sulfonylmethyl]furan-2-carboxylate
InChIKeyZIQVEAJAOQEMSS-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)CC2=CC=C(O2)C(=O)OC

Computed by PubChem (NCBI)