CAS 1811510-58-3 appears in our catalog under these names: MAP4K4–IN–3, MAP4K4-IN-3, 99.15%, MAP4K4-IN-3, 99.50% ,, 99.50% ,, MAP4K4-IN-3/ 99.5% (existing batch purity). Offered by: GLPBio, MedChemExpress, Chemat, TargetMol. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 200 mg, 10mM/1mL, 5 mg.
5-[6-amino-5-(4-chlorophenyl)-3-pyridinyl]pyrimidin-2-amine (CAS 1811510-58-3) is a chemical compound with the molecular formula C15H12ClN5 and a molecular weight of 297.74 g/mol. IUPAC name: 5-[6-amino-5-(4-chlorophenyl)-3-pyridinyl]pyrimidin-2-amine. InChIKey: KSQDIECZAQKQQW-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN5 |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | 5-[6-amino-5-(4-chlorophenyl)-3-pyridinyl]pyrimidin-2-amine |
| InChIKey | KSQDIECZAQKQQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CC(=C2)C3=CN=C(N=C3)N)N)Cl |
Computed by PubChem (NCBI)