CAS 1811569-16-0 appears in our catalog under these names: (S)-1-(2-Iodoacetyl)pyrrolidine-2-carbonitrile, 98%, Vildagliptin Impurity 72. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-(2-iodoacetyl)pyrrolidine-2-carbonitrile (CAS 1811569-16-0) is a chemical compound with the molecular formula C7H9IN2O and a molecular weight of 264.06 g/mol. IUPAC name: (2S)-1-(2-iodoacetyl)pyrrolidine-2-carbonitrile. InChIKey: MSDFJUNHUCWAHG-LURJTMIESA-N.
| Molecular formula | C7H9IN2O |
|---|---|
| Molecular weight | 264.06 g/mol |
| IUPAC name | (2S)-1-(2-iodoacetyl)pyrrolidine-2-carbonitrile |
| InChIKey | MSDFJUNHUCWAHG-LURJTMIESA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CI)C#N |
Computed by PubChem (NCBI)