CAS 2329572-88-3 is the registry number for (R)-3-Iodo-6-methyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6R)-3-iodo-6-methyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole (CAS 2329572-88-3) is a chemical compound with the molecular formula C7H9IN2O and a molecular weight of 264.06 g/mol. IUPAC name: (6R)-3-iodo-6-methyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole. InChIKey: VIDJJCMVUOQHNW-SCSAIBSYSA-N.
| Molecular formula | C7H9IN2O |
|---|---|
| Molecular weight | 264.06 g/mol |
| IUPAC name | (6R)-3-iodo-6-methyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
| InChIKey | VIDJJCMVUOQHNW-SCSAIBSYSA-N |
| SMILES | C[C@@H]1CC2=C(CO1)C(=NN2)I |
Computed by PubChem (NCBI)