CAS 1812-33-5 is the registry number for N1-Methyl Bromazepam, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
7-bromo-1-methyl-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-one (CAS 1812-33-5) is a chemical compound with the molecular formula C15H12BrN3O and a molecular weight of 330.18 g/mol. IUPAC name: 7-bromo-1-methyl-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-one. InChIKey: GIBKFDFZIZIKGJ-UHFFFAOYSA-N.
| Molecular formula | C15H12BrN3O |
|---|---|
| Molecular weight | 330.18 g/mol |
| IUPAC name | 7-bromo-1-methyl-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-one |
| InChIKey | GIBKFDFZIZIKGJ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN=C(C2=C1C=CC(=C2)Br)C3=CC=CC=N3 |
Computed by PubChem (NCBI)