CAS 868350-97-4 appears in our catalog under these names: Bromazepam EP Impurity C, 6-Methyl Bromazepam, >95% (HPLC), 7-Bromo-5-(6-methylpyridin-2-yl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one, 6-Methyl bromazepam. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg.
7-bromo-5-(6-methyl-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 868350-97-4) is a chemical compound with the molecular formula C15H12BrN3O and a molecular weight of 330.18 g/mol. IUPAC name: 7-bromo-5-(6-methyl-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: QZOXQUQNSNCNFD-UHFFFAOYSA-N.
| Molecular formula | C15H12BrN3O |
|---|---|
| Molecular weight | 330.18 g/mol |
| IUPAC name | 7-bromo-5-(6-methyl-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | QZOXQUQNSNCNFD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=NCC(=O)NC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)