Products 1812886-56-8
CAS 1812886-56-8 is the registry number for 4-Acetyl-2-(1,1-dimethylethyl)hydrazidebenzoic Acid. Offered by: TRC. Available pack sizes: 1g.
4-acetyl-N'-tert-butylbenzohydrazide (CAS 1812886-56-8) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: 4-acetyl-N'-tert-butylbenzohydrazide. InChIKey: DIADQLRTLVNSDQ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 4-acetyl-N'-tert-butylbenzohydrazide |
| InChIKey | DIADQLRTLVNSDQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)NNC(C)(C)C |
Computed by PubChem (NCBI)