CAS 1814293-88-3 is the registry number for 3-(4-Bromo-2-fluorophenyl)pentanedioic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-bromo-2-fluorophenyl)pentanedioic acid (CAS 1814293-88-3) is a chemical compound with the molecular formula C11H10BrFO4 and a molecular weight of 305.10 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)pentanedioic acid. InChIKey: RXUZJLHFTVMVBS-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO4 |
|---|---|
| Molecular weight | 305.10 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)pentanedioic acid |
| InChIKey | RXUZJLHFTVMVBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)