CAS 2451907-95-0 is the registry number for 7-Bromo-5-fluoro-2,2-dimethyl-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-fluoro-2,2-dimethyl-3H-1,4-benzodioxine-6-carboxylic acid (CAS 2451907-95-0) is a chemical compound with the molecular formula C11H10BrFO4 and a molecular weight of 305.10 g/mol. IUPAC name: 7-bromo-5-fluoro-2,2-dimethyl-3H-1,4-benzodioxine-6-carboxylic acid. InChIKey: DNDZAFYGEAZTOM-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO4 |
|---|---|
| Molecular weight | 305.10 g/mol |
| IUPAC name | 7-bromo-5-fluoro-2,2-dimethyl-3H-1,4-benzodioxine-6-carboxylic acid |
| InChIKey | DNDZAFYGEAZTOM-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C(C(=C(C=C2O1)Br)C(=O)O)F)C |
Computed by PubChem (NCBI)