Products 181517-15-7
CAS 181517-15-7 is the registry number for Uracil 4,5-13c2. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(4,5-13C2)1H-pyrimidine-2,4-dione (CAS 181517-15-7) is a chemical compound with the molecular formula C4H4N2O2 and a molecular weight of 114.07 g/mol. IUPAC name: (4,5-13C2)1H-pyrimidine-2,4-dione. InChIKey: ISAKRJDGNUQOIC-ZKDXJZICSA-N.
| Molecular formula | C4H4N2O2 |
|---|---|
| Molecular weight | 114.07 g/mol |
| IUPAC name | (4,5-13C2)1H-pyrimidine-2,4-dione |
| InChIKey | ISAKRJDGNUQOIC-ZKDXJZICSA-N |
| SMILES | C1=[13CH][13C](=O)NC(=O)N1 |
Computed by PubChem (NCBI)