CAS 1817022-62-0 is the registry number for 2–Chlorothiazole–4–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1817022-62-0) is a chemical compound with the molecular formula C9H13BClNO2S and a molecular weight of 245.54 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: RVDBHHWFSSZRSA-UHFFFAOYSA-N.
| Molecular formula | C9H13BClNO2S |
|---|---|
| Molecular weight | 245.54 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | RVDBHHWFSSZRSA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=N2)Cl |
Computed by PubChem (NCBI)