CAS 889672-72-4 appears in our catalog under these names: 2–Chloro–5–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)thiazole, 2-Chloro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, 2-chlorothiazol-5-ylboronic acid pinacol ester, 98%, 98%, (2-Chlorothiazol-5-yl)boronic acid pinacol ester, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 0,5g, 100mg, 1g.
2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 889672-72-4) is a chemical compound with the molecular formula C9H13BClNO2S and a molecular weight of 245.54 g/mol. IUPAC name: 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: UAXMSLFTXSRLPV-UHFFFAOYSA-N.
| Molecular formula | C9H13BClNO2S |
|---|---|
| Molecular weight | 245.54 g/mol |
| IUPAC name | 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | UAXMSLFTXSRLPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)Cl |
Computed by PubChem (NCBI)