CAS 1817645-57-0 appears in our catalog under these names: (1R,3R)-3-Aminocyclohexan-1-ol hydrochloride, 95%, (1R,3R)–3–Aminocyclohexanol hydrochloride, (1R,3R)-3-Aminocyclohexanol hydrochloride, 95%+, 95%+, (1R,3R)-3-Aminocyclohexan-1-ol hydrochloride, 97%, (1R,3R)-3-Aminocyclohexanol hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 500mg, 10g.
Trans-(1R,3R)-3-aminocyclohexan-1-ol;hydrochloride (CAS 1817645-57-0) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: trans-(1R,3R)-3-aminocyclohexan-1-ol;hydrochloride. InChIKey: NJGXTVICXVECGR-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | trans-(1R,3R)-3-aminocyclohexan-1-ol;hydrochloride |
| InChIKey | NJGXTVICXVECGR-KGZKBUQUSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)O)N.Cl |
Computed by PubChem (NCBI)