Products 181769-57-3
CAS 181769-57-3 appears in our catalog under these names: Calpain Inhibitor XII, Calpain Inhibitor XII, (Rac)-Calpain Inhibitor XII, 99.04%, Benzyl (1-((1,2-dioxo-1-((pyridin-2-ylmethyl)amino)hexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate, ≥90%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 25mg, 5 mg, 100mg.
Benzyl N-[1-[[1,2-dioxo-1-(pyridin-2-ylmethylamino)hexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (CAS 181769-57-3) is a chemical compound with the molecular formula C26H34N4O5 and a molecular weight of 482.6 g/mol. IUPAC name: benzyl N-[1-[[1,2-dioxo-1-(pyridin-2-ylmethylamino)hexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate. InChIKey: PLVWMBFPIAQRHK-UHFFFAOYSA-N.
| Molecular formula | C26H34N4O5 |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | benzyl N-[1-[[1,2-dioxo-1-(pyridin-2-ylmethylamino)hexan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | PLVWMBFPIAQRHK-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)C(=O)NCC1=CC=CC=N1)NC(=O)C(CC(C)C)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)