Products 2254005-15-5
CAS 2254005-15-5 is the registry number for NBD AA. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: Get quote, 1MG.
(5Z,8Z,11Z,14Z)-20-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]icosa-5,8,11,14-tetraenoic acid (CAS 2254005-15-5) is a chemical compound with the molecular formula C26H34N4O5 and a molecular weight of 482.6 g/mol. IUPAC name: (5Z,8Z,11Z,14Z)-20-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]icosa-5,8,11,14-tetraenoic acid. InChIKey: LUUPGKFIPNBQCK-DTLRTWKJSA-N.
| Molecular formula | C26H34N4O5 |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | (5Z,8Z,11Z,14Z)-20-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]icosa-5,8,11,14-tetraenoic acid |
| InChIKey | LUUPGKFIPNBQCK-DTLRTWKJSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NCCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
Computed by PubChem (NCBI)