Products 1818868-43-7

CAS 1818868-43-7 is the registry number for 8-(Hydroxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-(hydroxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (CAS 1818868-43-7) is a chemical compound with the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. IUPAC name: 8-(hydroxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid. InChIKey: FXPXKWHLYHLSNW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O5
Molecular weight216.23 g/mol
IUPAC name8-(hydroxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid
InChIKeyFXPXKWHLYHLSNW-UHFFFAOYSA-N
SMILESC1CC2(CCC1(CO)C(=O)O)OCCO2

Computed by PubChem (NCBI)