Products 181961-24-0
CAS 181961-24-0 is the registry number for Cyclo(Pro-dArg), 98.12%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg.
2-[3-[(3R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]propyl]guanidine (CAS 181961-24-0) is a chemical compound with the molecular formula C11H19N5O2 and a molecular weight of 253.30 g/mol. IUPAC name: 2-[3-[(3R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]propyl]guanidine. InChIKey: ZRJHYOXNWCMGMW-SFYZADRCSA-N.
| Molecular formula | C11H19N5O2 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 2-[3-[(3R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]propyl]guanidine |
| InChIKey | ZRJHYOXNWCMGMW-SFYZADRCSA-N |
| SMILES | C1C[C@H]2C(=O)N[C@@H](C(=O)N2C1)CCCN=C(N)N |
Computed by PubChem (NCBI)