Products 91419-64-6

CAS 91419-64-6 is the registry number for tert-Butyl 3-(1H-tetrazol-5-yl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(2H-tetrazol-5-yl)piperidine-1-carboxylate (CAS 91419-64-6) is a chemical compound with the molecular formula C11H19N5O2 and a molecular weight of 253.30 g/mol. IUPAC name: tert-butyl 3-(2H-tetrazol-5-yl)piperidine-1-carboxylate. InChIKey: IJGIPCAPKVENLU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19N5O2
Molecular weight253.30 g/mol
IUPAC nametert-butyl 3-(2H-tetrazol-5-yl)piperidine-1-carboxylate
InChIKeyIJGIPCAPKVENLU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)C2=NNN=N2

Computed by PubChem (NCBI)