CAS 1820001-72-6 appears in our catalog under these names: Baloxavir Marboxil Impurity 8, Baloxavir Marboxil Impurity 5, 7-fluoro-6,11-dihydrodibenzo(b,e)thiepin-11-ol, 98%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g.
7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol (CAS 1820001-72-6) is a chemical compound with the molecular formula C14H11FOS and a molecular weight of 246.30 g/mol. IUPAC name: 7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol. InChIKey: VGDNIFFFGHJGRF-UHFFFAOYSA-N.
| Molecular formula | C14H11FOS |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol |
| InChIKey | VGDNIFFFGHJGRF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2F)C(C3=CC=CC=C3S1)O |
Computed by PubChem (NCBI)