Products 1820001-80-6

CAS 1820001-80-6 is the registry number for Baloxavir Marboxil Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol (CAS 1820001-80-6) is a chemical compound with the molecular formula C14H11FOS and a molecular weight of 246.30 g/mol. IUPAC name: 8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol. InChIKey: VJWTVMYNFPBIRE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11FOS
Molecular weight246.30 g/mol
IUPAC name8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol
InChIKeyVJWTVMYNFPBIRE-UHFFFAOYSA-N
SMILESC1C2=C(C=CC(=C2)F)C(C3=CC=CC=C3S1)O

Computed by PubChem (NCBI)