CAS 1820001-80-6 is the registry number for Baloxavir Marboxil Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol (CAS 1820001-80-6) is a chemical compound with the molecular formula C14H11FOS and a molecular weight of 246.30 g/mol. IUPAC name: 8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol. InChIKey: VJWTVMYNFPBIRE-UHFFFAOYSA-N.
| Molecular formula | C14H11FOS |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol |
| InChIKey | VJWTVMYNFPBIRE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)F)C(C3=CC=CC=C3S1)O |
Computed by PubChem (NCBI)