CAS 182003-84-5 is the registry number for Methyl 3–Bromo–4–(methylsulfonyl)benzoate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Methyl 3-bromo-4-methylsulfonylbenzoate (CAS 182003-84-5) is a chemical compound with the molecular formula C9H9BrO4S and a molecular weight of 293.14 g/mol. IUPAC name: methyl 3-bromo-4-methylsulfonylbenzoate. InChIKey: WOUKHGQKKHAEFL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4S |
|---|---|
| Molecular weight | 293.14 g/mol |
| IUPAC name | methyl 3-bromo-4-methylsulfonylbenzoate |
| InChIKey | WOUKHGQKKHAEFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)S(=O)(=O)C)Br |
Computed by PubChem (NCBI)