CAS 200643-57-8 is the registry number for 3-[(4-Bromophenyl)sulfonyl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(4-bromophenyl)sulfonylpropanoic acid (CAS 200643-57-8) is a chemical compound with the molecular formula C9H9BrO4S and a molecular weight of 293.14 g/mol. IUPAC name: 3-(4-bromophenyl)sulfonylpropanoic acid. InChIKey: VIZYBBUNMITQFV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4S |
|---|---|
| Molecular weight | 293.14 g/mol |
| IUPAC name | 3-(4-bromophenyl)sulfonylpropanoic acid |
| InChIKey | VIZYBBUNMITQFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CCC(=O)O)Br |
Computed by PubChem (NCBI)