CAS 1820569-52-5 is the registry number for Rac-(1r,2r,6s,7s)-4-azatricyclo[5.2.2.0(2,6)]undecane hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S,6R)-4-azatricyclo[5.2.2.02,6]undecane;hydrochloride (CAS 1820569-52-5) is a chemical compound with the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. IUPAC name: (2S,6R)-4-azatricyclo[5.2.2.02,6]undecane;hydrochloride. InChIKey: WOTCSHZVGJMSRR-UAAGSAOOSA-N.
| Molecular formula | C10H18ClN |
|---|---|
| Molecular weight | 187.71 g/mol |
| IUPAC name | (2S,6R)-4-azatricyclo[5.2.2.02,6]undecane;hydrochloride |
| InChIKey | WOTCSHZVGJMSRR-UAAGSAOOSA-N |
| SMILES | C1CC2CCC1[C@H]3[C@@H]2CNC3.Cl |
Computed by PubChem (NCBI)