CAS 2225132-07-8 is the registry number for (1R,5R)-6,6-Dimethyl-2-methylidenebicyclo(3.1.1)heptan-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,5R)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-amine;hydrochloride (CAS 2225132-07-8) is a chemical compound with the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. IUPAC name: (1R,5R)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-amine;hydrochloride. InChIKey: SQSDBXYJKLVZJR-AHRMMNEWSA-N.
| Molecular formula | C10H18ClN |
|---|---|
| Molecular weight | 187.71 g/mol |
| IUPAC name | (1R,5R)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-amine;hydrochloride |
| InChIKey | SQSDBXYJKLVZJR-AHRMMNEWSA-N |
| SMILES | CC1([C@@H]2C[C@H]1C(=C)C(C2)N)C.Cl |
Computed by PubChem (NCBI)