Products 1820569-81-0
CAS 1820569-81-0 is the registry number for 2-(1,5-Dimethyl-1H-pyrazol-4-yl)-1-methyl-5-oxopyrrolidine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3R)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidine-3-carboxamide (CAS 1820569-81-0) is a chemical compound with the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. IUPAC name: (2R,3R)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidine-3-carboxamide. InChIKey: GEZDMXZGKNMDOZ-GMSGAONNSA-N.
| Molecular formula | C11H16N4O2 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2R,3R)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidine-3-carboxamide |
| InChIKey | GEZDMXZGKNMDOZ-GMSGAONNSA-N |
| SMILES | CC1=C(C=NN1C)[C@H]2[C@@H](CC(=O)N2C)C(=O)N |
Computed by PubChem (NCBI)